C31H27FO6S — CID 155241642
ethenyl 9-ethyl-7-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]-3-methylphenyl]sulfanylcarbonyl-9H-fluorene-2-carboxylate (PubChem CID 155241642) has the molecular formula C31H27FO6S and a molecular weight of 546.62 g/mol. Its IUPAC name is ethenyl 9-ethyl-7-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]-3-methylphenyl]sulfanylcarbonyl-9H-fluorene-2-carboxylate.
| Compound Name | ethenyl 9-ethyl-7-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]-3-methylphenyl]sulfanylcarbonyl-9H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 155241642 |
| Molecular Formula | C31H27FO6S |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | ethenyl 9-ethyl-7-[4-[2-(2-fluoroprop-2-enoyloxy)ethoxy]-3-methylphenyl]sulfanylcarbonyl-9H-fluorene-2-carboxylate |
| SMILES | C=COC(=O)c1ccc2c(c1)C(CC)c1cc(C(=O)Sc3ccc(OCCOC(=O)C(=C)F)c(C)c3)ccc1-2 |
| InChI | InChI=1S/C31H27FO6S/c1-5-23-26-16-20(30(34)36-6-2)7-10-24(26)25-11-8-21(17-27(23)25)31(35)39-22-9-12-28(18(3)15-22)37-13-14-38-29(33)19(4)32/h6-12,15-17,23H,2,4-5,13-14H2,1,3H3 |
| InChIKey | UGUNNGBVARMJNX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|