C35H34FNO7S — CID 155242039
4-[4-[4-[4-[4-(2,5-dioxopyrrol-1-yl)butoxy]benzoyl]sulfanylphenyl]-2-methylphenoxy]butyl 2-fluoroprop-2-enoate (PubChem CID 155242039) has the molecular formula C35H34FNO7S and a molecular weight of 631.72 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-(2,5-dioxopyrrol-1-yl)butoxy]benzoyl]sulfanylphenyl]-2-methylphenoxy]butyl 2-fluoroprop-2-enoate.
| Compound Name | 4-[4-[4-[4-[4-(2,5-dioxopyrrol-1-yl)butoxy]benzoyl]sulfanylphenyl]-2-methylphenoxy]butyl 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 155242039 |
| Molecular Formula | C35H34FNO7S |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | 4-[4-[4-[4-[4-(2,5-dioxopyrrol-1-yl)butoxy]benzoyl]sulfanylphenyl]-2-methylphenoxy]butyl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCCCCOc1ccc(-c2ccc(SC(=O)c3ccc(OCCCCN4C(=O)C=CC4=O)cc3)cc2)cc1C |
| InChI | InChI=1S/C35H34FNO7S/c1-24-23-28(11-16-31(24)43-21-5-6-22-44-34(40)25(2)36)26-9-14-30(15-10-26)45-35(41)27-7-12-29(13-8-27)42-20-4-3-19-37-32(38)17-18-33(37)39/h7-18,23H,2-6,19-22H2,1H3 |
| InChIKey | WAJFSDJOZFKYPU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|