C40H41NO10 — CID 154625123
1-O-[3-[4-[[7-[3-(2,5-dioxopyrrol-1-yl)propoxy]-9-methyl-9H-fluoren-2-yl]oxycarbonyl]-2-methylphenoxy]propyl] 4-O-propyl 2-methylidenebutanedioate (PubChem CID 154625123) has the molecular formula C40H41NO10 and a molecular weight of 695.76 g/mol. Its IUPAC name is 1-O-[3-[4-[[7-[3-(2,5-dioxopyrrol-1-yl)propoxy]-9-methyl-9H-fluoren-2-yl]oxycarbonyl]-2-methylphenoxy]propyl] 4-O-propyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[3-[4-[[7-[3-(2,5-dioxopyrrol-1-yl)propoxy]-9-methyl-9H-fluoren-2-yl]oxycarbonyl]-2-methylphenoxy]propyl] 4-O-propyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625123 |
| Molecular Formula | C40H41NO10 |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | 1-O-[3-[4-[[7-[3-(2,5-dioxopyrrol-1-yl)propoxy]-9-methyl-9H-fluoren-2-yl]oxycarbonyl]-2-methylphenoxy]propyl] 4-O-propyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCCC)C(=O)OCCCOc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OCCCN4C(=O)C=CC4=O)ccc2-3)cc1C |
| InChI | InChI=1S/C40H41NO10/c1-5-17-49-38(44)22-26(3)39(45)50-20-7-19-48-35-13-8-28(21-25(35)2)40(46)51-30-10-12-32-31-11-9-29(23-33(31)27(4)34(32)24-30)47-18-6-16-41-36(42)14-15-37(41)43/h8-15,21,23-24,27H,3,5-7,16-20,22H2,1-2,4H3 |
| InChIKey | IMISTXLFBHRNIV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|