C38H38O12 — CID 154625106
4-O-methyl 1-O-[3-[4-[[9-methyl-7-(4-prop-2-enoyloxybutoxycarbonyloxy)-9H-fluoren-2-yl]oxycarbonyl]phenoxy]propyl] 2-methylidenebutanedioate (PubChem CID 154625106) has the molecular formula C38H38O12 and a molecular weight of 686.71 g/mol. Its IUPAC name is 4-O-methyl 1-O-[3-[4-[[9-methyl-7-(4-prop-2-enoyloxybutoxycarbonyloxy)-9H-fluoren-2-yl]oxycarbonyl]phenoxy]propyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-methyl 1-O-[3-[4-[[9-methyl-7-(4-prop-2-enoyloxybutoxycarbonyloxy)-9H-fluoren-2-yl]oxycarbonyl]phenoxy]propyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625106 |
| Molecular Formula | C38H38O12 |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | 4-O-methyl 1-O-[3-[4-[[9-methyl-7-(4-prop-2-enoyloxybutoxycarbonyloxy)-9H-fluoren-2-yl]oxycarbonyl]phenoxy]propyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc2c(c1)C(C)c1cc(OC(=O)c3ccc(OCCCOC(=O)C(=C)CC(=O)OC)cc3)ccc1-2 |
| InChI | InChI=1S/C38H38O12/c1-5-34(39)46-17-6-7-18-48-38(43)50-29-14-16-31-30-15-13-28(22-32(30)25(3)33(31)23-29)49-37(42)26-9-11-27(12-10-26)45-19-8-20-47-36(41)24(2)21-35(40)44-4/h5,9-16,22-23,25H,1-2,6-8,17-21H2,3-4H3 |
| InChIKey | MKLHZNODWAWFAH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|