C42H48O10 — CID 154625178
4-O-cyclohexyl 1-O-[6-[4-[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl]phenoxy]hexyl] 2-methylidenebutanedioate (PubChem CID 154625178) has the molecular formula C42H48O10 and a molecular weight of 712.84 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[6-[4-[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl]phenoxy]hexyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[6-[4-[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl]phenoxy]hexyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625178 |
| Molecular Formula | C42H48O10 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.32 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[6-[4-[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl]phenoxy]hexyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCCOC(=O)C(=C)CC(=O)OC4CCCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H48O10/c1-3-39(43)49-29-11-28-48-36-22-18-34(19-23-36)42(46)52-38-24-16-33(17-25-38)32-14-20-35(21-15-32)47-26-9-4-5-10-27-50-41(45)31(2)30-40(44)51-37-12-7-6-8-13-37/h3,14-25,37H,1-2,4-13,26-30H2 |
| InChIKey | UVDVNYRCJIJONY-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|