C36H44O10 — CID 154625142
4-O-cyclohexyl 1-O-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylphenoxy]hexyl] 2-methylidenebutanedioate (PubChem CID 154625142) has the molecular formula C36H44O10 and a molecular weight of 636.74 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylphenoxy]hexyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylphenoxy]hexyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154625142 |
| Molecular Formula | C36H44O10 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[6-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylphenoxy]hexyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(OC(=O)c2ccc(OCCCCCCOC(=O)C(=C)CC(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C36H44O10/c1-3-33(37)43-25-11-24-42-30-18-20-32(21-19-30)46-36(40)28-14-16-29(17-15-28)41-22-9-4-5-10-23-44-35(39)27(2)26-34(38)45-31-12-7-6-8-13-31/h3,14-21,31H,1-2,4-13,22-26H2 |
| InChIKey | MJGFMUITGYIXQM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|