C34H38O10 — CID 154624968
4-O-cyclohexyl 1-O-[3-[4-[(E)-3-[4-(2-prop-2-enoyloxyethoxy)phenyl]prop-2-enoyl]oxyphenoxy]propyl] 2-methylidenebutanedioate (PubChem CID 154624968) has the molecular formula C34H38O10 and a molecular weight of 606.67 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[3-[4-[(E)-3-[4-(2-prop-2-enoyloxyethoxy)phenyl]prop-2-enoyl]oxyphenoxy]propyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[3-[4-[(E)-3-[4-(2-prop-2-enoyloxyethoxy)phenyl]prop-2-enoyl]oxyphenoxy]propyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624968 |
| Molecular Formula | C34H38O10 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[3-[4-[(E)-3-[4-(2-prop-2-enoyloxyethoxy)phenyl]prop-2-enoyl]oxyphenoxy]propyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCOc1ccc(/C=C/C(=O)Oc2ccc(OCCCOC(=O)C(=C)CC(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H38O10/c1-3-31(35)41-23-22-40-27-13-10-26(11-14-27)12-19-32(36)43-30-17-15-28(16-18-30)39-20-7-21-42-34(38)25(2)24-33(37)44-29-8-5-4-6-9-29/h3,10-19,29H,1-2,4-9,20-24H2/b19-12+ |
| InChIKey | KEFNFGFXTLPKIA-XDHOZWIPSA-N |
| XLogP | 5.55 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|