C35H34O9 — CID 154624924
4-O-ethyl 1-O-[2-methyl-4-[(E)-3-oxo-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenoxy]prop-1-enyl]phenyl] 2-methylidenebutanedioate (PubChem CID 154624924) has the molecular formula C35H34O9 and a molecular weight of 598.65 g/mol. Its IUPAC name is 4-O-ethyl 1-O-[2-methyl-4-[(E)-3-oxo-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenoxy]prop-1-enyl]phenyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-ethyl 1-O-[2-methyl-4-[(E)-3-oxo-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenoxy]prop-1-enyl]phenyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 154624924 |
| Molecular Formula | C35H34O9 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 4-O-ethyl 1-O-[2-methyl-4-[(E)-3-oxo-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]phenoxy]prop-1-enyl]phenyl] 2-methylidenebutanedioate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(OC(=O)/C=C/c3ccc(OC(=O)C(=C)CC(=O)OCC)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C35H34O9/c1-5-32(36)42-21-7-20-41-29-14-10-27(11-15-29)28-12-16-30(17-13-28)43-33(37)19-9-26-8-18-31(24(3)22-26)44-35(39)25(4)23-34(38)40-6-2/h5,8-19,22H,1,4,6-7,20-21,23H2,2-3H3/b19-9+ |
| InChIKey | YZKLMOOBBAMCKZ-DJKKODMXSA-N |
| XLogP | 6.19 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|