C34H32O9 — CID 129281761
[3-methyl-4-[(E)-3-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 129281761) has the molecular formula C34H32O9 and a molecular weight of 584.62 g/mol. Its IUPAC name is [3-methyl-4-[(E)-3-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | [3-methyl-4-[(E)-3-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 129281761 |
| Molecular Formula | C34H32O9 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | [3-methyl-4-[(E)-3-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(/C=C/C(=O)Oc2ccc(OC(=O)c3ccc(OC(=O)C(=C)C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C34H32O9/c1-22(2)32(36)40-20-6-19-39-27-12-7-25(8-13-27)9-18-31(35)43-30-17-16-29(21-24(30)5)42-34(38)26-10-14-28(15-11-26)41-33(37)23(3)4/h7-18,21H,1,3,6,19-20H2,2,4-5H3/b18-9+ |
| InChIKey | LVPKDDXSGCSJAJ-GIJQJNRQSA-N |
| XLogP | 6.20 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|