C32H37NO7 — CID 123840848
[4-[3-[8-(2-methylprop-2-enoyloxy)octoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate (PubChem CID 123840848) has the molecular formula C32H37NO7 and a molecular weight of 547.65 g/mol. Its IUPAC name is [4-[3-[8-(2-methylprop-2-enoyloxy)octoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate.
| Compound Name | [4-[3-[8-(2-methylprop-2-enoyloxy)octoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate |
|---|---|
| PubChem CID | 123840848 |
| Molecular Formula | C32H37NO7 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | [4-[3-[8-(2-methylprop-2-enoyloxy)octoxy]-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOC(=O)C=Cc1ccc(OC(=O)c2ccc(OCCCC#N)cc2)cc1 |
| InChI | InChI=1S/C32H37NO7/c1-25(2)31(35)39-24-9-6-4-3-5-8-23-38-30(34)20-13-26-11-16-29(17-12-26)40-32(36)27-14-18-28(19-15-27)37-22-10-7-21-33/h11-20H,1,3-10,22-24H2,2H3 |
| InChIKey | DJPHLBUFVDDNTR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|