C28H33NO6 — CID 86732655
[4-[(E)-3-(8-hydroxyoctoxy)-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate (PubChem CID 86732655) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is [4-[(E)-3-(8-hydroxyoctoxy)-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate.
| Compound Name | [4-[(E)-3-(8-hydroxyoctoxy)-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate |
|---|---|
| PubChem CID | 86732655 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | [4-[(E)-3-(8-hydroxyoctoxy)-3-oxoprop-1-enyl]phenyl] 4-(3-cyanopropoxy)benzoate |
| SMILES | N#CCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OCCCCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C28H33NO6/c29-19-5-8-21-33-25-16-12-24(13-17-25)28(32)35-26-14-9-23(10-15-26)11-18-27(31)34-22-7-4-2-1-3-6-20-30/h9-18,30H,1-8,20-22H2/b18-11+ |
| InChIKey | WQKYLXCNUOTQII-WOJGMQOQSA-N |
| XLogP | 5.48 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|