C24H24N2O5 — CID 129147443
[4-[(E)-3-hydroxyprop-1-enyl]phenyl] 3,5-bis(3-cyanopropoxy)benzoate (PubChem CID 129147443) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [4-[(E)-3-hydroxyprop-1-enyl]phenyl] 3,5-bis(3-cyanopropoxy)benzoate.
| Compound Name | [4-[(E)-3-hydroxyprop-1-enyl]phenyl] 3,5-bis(3-cyanopropoxy)benzoate |
|---|---|
| PubChem CID | 129147443 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [4-[(E)-3-hydroxyprop-1-enyl]phenyl] 3,5-bis(3-cyanopropoxy)benzoate |
| SMILES | N#CCCCOc1cc(OCCCC#N)cc(C(=O)Oc2ccc(/C=C/CO)cc2)c1 |
| InChI | InChI=1S/C24H24N2O5/c25-11-1-3-14-29-22-16-20(17-23(18-22)30-15-4-2-12-26)24(28)31-21-9-7-19(8-10-21)6-5-13-27/h5-10,16-18,27H,1-4,13-15H2/b6-5+ |
| InChIKey | VPNJQAFCJLPSGN-AATRIKPKSA-N |
| XLogP | 4.28 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|