C53H75NO6 — CID 102404541
[4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]phenyl] 3,4,5-tris-decoxybenzoate (PubChem CID 102404541) has the molecular formula C53H75NO6 and a molecular weight of 822.18 g/mol. Its IUPAC name is [4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]phenyl] 3,4,5-tris-decoxybenzoate.
| Compound Name | [4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]phenyl] 3,4,5-tris-decoxybenzoate |
|---|---|
| PubChem CID | 102404541 |
| Molecular Formula | C53H75NO6 |
| Molecular Weight | 822.18 g/mol |
| Exact Mass | 821.56 |
| IUPAC Name | [4-[(E)-3-(4-cyanophenyl)-3-oxoprop-1-enyl]phenyl] 3,4,5-tris-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1cc(C(=O)Oc2ccc(/C=C/C(=O)c3ccc(C#N)cc3)cc2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C53H75NO6/c1-4-7-10-13-16-19-22-25-38-57-50-41-47(53(56)60-48-35-30-44(31-36-48)32-37-49(55)46-33-28-45(43-54)29-34-46)42-51(58-39-26-23-20-17-14-11-8-5-2)52(50)59-40-27-24-21-18-15-12-9-6-3/h28-37,41-42H,4-27,38-40H2,1-3H3/b37-32+ |
| InChIKey | HOAHROCDZZDTCS-BQNXFWFHSA-N |
| XLogP | 15.23 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.18 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|