C20H17F3O5 — CID 59850420
(E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 59850420) has the molecular formula C20H17F3O5 and a molecular weight of 394.35 g/mol. Its IUPAC name is (E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59850420 |
| Molecular Formula | C20H17F3O5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (E)-3-[4-[4-(4,4,4-trifluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3O5/c21-20(22,23)12-1-13-27-16-9-5-15(6-10-16)19(26)28-17-7-2-14(3-8-17)4-11-18(24)25/h2-11H,1,12-13H2,(H,24,25)/b11-4+ |
| InChIKey | PTXMRQLIAQYLKJ-NYYWCZLTSA-N |
| XLogP | 4.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|