C20H14F6O5 — CID 87420853
(E)-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 87420853) has the molecular formula C20H14F6O5 and a molecular weight of 448.32 g/mol. Its IUPAC name is (E)-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87420853 |
| Molecular Formula | C20H14F6O5 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (E)-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(=O)c2ccc(OCC(F)(F)C(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H14F6O5/c21-18(20(24,25)26)19(22,23)11-30-14-8-4-13(5-9-14)17(29)31-15-6-1-12(2-7-15)3-10-16(27)28/h1-10,18H,11H2,(H,27,28)/b10-3+ |
| InChIKey | SJQHGXNZCDLHFI-XCVCLJGOSA-N |
| XLogP | 4.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|