C27H22F6N2O5 — CID 87168851
(E)-2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 87168851) has the molecular formula C27H22F6N2O5 and a molecular weight of 568.47 g/mol. Its IUPAC name is (E)-2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87168851 |
| Molecular Formula | C27H22F6N2O5 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | (E)-2-[(3,5-diaminophenyl)methyl]-3-[4-[4-(2,2,3,4,4,4-hexafluorobutoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | Nc1cc(N)cc(C/C(=C\c2ccc(OC(=O)c3ccc(OCC(F)(F)C(F)C(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C27H22F6N2O5/c28-25(27(31,32)33)26(29,30)14-39-21-7-3-17(4-8-21)24(38)40-22-5-1-15(2-6-22)9-18(23(36)37)10-16-11-19(34)13-20(35)12-16/h1-9,11-13,25H,10,14,34-35H2,(H,36,37)/b18-9+ |
| InChIKey | QHXRGUNMVRNSLM-GIJQJNRQSA-N |
| XLogP | 5.70 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|