C27H25F3N2O5 — CID 66822885
5-(3,5-diaminophenyl)-2-[[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid (PubChem CID 66822885) has the molecular formula C27H25F3N2O5 and a molecular weight of 514.50 g/mol. Its IUPAC name is 5-(3,5-diaminophenyl)-2-[[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid.
| Compound Name | 5-(3,5-diaminophenyl)-2-[[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid |
|---|---|
| PubChem CID | 66822885 |
| Molecular Formula | C27H25F3N2O5 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 5-(3,5-diaminophenyl)-2-[[4-[4-(2,2,2-trifluoroethoxy)benzoyl]oxyphenyl]methylidene]pentanoic acid |
| SMILES | Nc1cc(N)cc(CCCC(=Cc2ccc(OC(=O)c3ccc(OCC(F)(F)F)cc3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C27H25F3N2O5/c28-27(29,30)16-36-23-10-6-19(7-11-23)26(35)37-24-8-4-17(5-9-24)12-20(25(33)34)3-1-2-18-13-21(31)15-22(32)14-18/h4-15H,1-3,16,31-32H2,(H,33,34) |
| InChIKey | PGLFORCGZYFFDV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|