C26H23F3N2O6 — CID 66823162
4-(3,5-diaminophenyl)-2-[[3-methoxy-4-[4-(trifluoromethoxy)benzoyl]oxyphenyl]methylidene]butanoic acid (PubChem CID 66823162) has the molecular formula C26H23F3N2O6 and a molecular weight of 516.47 g/mol. Its IUPAC name is 4-(3,5-diaminophenyl)-2-[[3-methoxy-4-[4-(trifluoromethoxy)benzoyl]oxyphenyl]methylidene]butanoic acid.
| Compound Name | 4-(3,5-diaminophenyl)-2-[[3-methoxy-4-[4-(trifluoromethoxy)benzoyl]oxyphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 66823162 |
| Molecular Formula | C26H23F3N2O6 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 4-(3,5-diaminophenyl)-2-[[3-methoxy-4-[4-(trifluoromethoxy)benzoyl]oxyphenyl]methylidene]butanoic acid |
| SMILES | COc1cc(C=C(CCc2cc(N)cc(N)c2)C(=O)O)ccc1OC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H23F3N2O6/c1-35-23-13-15(10-18(24(32)33)4-2-16-11-19(30)14-20(31)12-16)3-9-22(23)36-25(34)17-5-7-21(8-6-17)37-26(27,28)29/h3,5-14H,2,4,30-31H2,1H3,(H,32,33) |
| InChIKey | RFJSKMJLHHBJGS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|