C21H19F3O7 — CID 142696040
[4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate (PubChem CID 142696040) has the molecular formula C21H19F3O7 and a molecular weight of 440.37 g/mol. Its IUPAC name is [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 142696040 |
| Molecular Formula | C21H19F3O7 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [4-[(E)-4,4-dihydroxy-3-oxohex-1-enyl]-2-methoxyphenyl] 4-(trifluoromethoxy)benzoate |
| SMILES | CCC(O)(O)C(=O)/C=C/c1ccc(OC(=O)c2ccc(OC(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H19F3O7/c1-3-20(27,28)18(25)11-5-13-4-10-16(17(12-13)29-2)30-19(26)14-6-8-15(9-7-14)31-21(22,23)24/h4-12,27-28H,3H2,1-2H3/b11-5+ |
| InChIKey | RIOBDCUNGSAHTM-VZUCSPMQSA-N |
| XLogP | 3.49 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|