C21H19F3O6 — CID 36835053
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxymethyl)benzoate (PubChem CID 36835053) has the molecular formula C21H19F3O6 and a molecular weight of 424.37 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxymethyl)benzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxymethyl)benzoate |
|---|---|
| PubChem CID | 36835053 |
| Molecular Formula | C21H19F3O6 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-(2,2,2-trifluoroethoxymethyl)benzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(COCC(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H19F3O6/c1-27-18-11-14(6-10-19(25)28-2)5-9-17(18)30-20(26)16-7-3-15(4-8-16)12-29-13-21(22,23)24/h3-11H,12-13H2,1-2H3/b10-6+ |
| InChIKey | RHRWZAZRQQBAPB-UXBLZVDNSA-N |
| XLogP | 4.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|