C30H38O8 — CID 54378502
[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 4-[6-(2,2-dimethylbutanoyloxy)hexoxy]benzoate (PubChem CID 54378502) has the molecular formula C30H38O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 4-[6-(2,2-dimethylbutanoyloxy)hexoxy]benzoate.
| Compound Name | [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 4-[6-(2,2-dimethylbutanoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 54378502 |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenyl] 4-[6-(2,2-dimethylbutanoyloxy)hexoxy]benzoate |
| SMILES | CCC(C)(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C=CC(=O)OC)cc2OC)cc1 |
| InChI | InChI=1S/C30H38O8/c1-6-30(2,3)29(33)37-20-10-8-7-9-19-36-24-15-13-23(14-16-24)28(32)38-25-17-11-22(21-26(25)34-4)12-18-27(31)35-5/h11-18,21H,6-10,19-20H2,1-5H3 |
| InChIKey | UYGOGEMYBGAIEY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|