C36H50O8 — CID 164762096
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyoctoxy]benzoate (PubChem CID 164762096) has the molecular formula C36H50O8 and a molecular weight of 610.79 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyoctoxy]benzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyoctoxy]benzoate |
|---|---|
| PubChem CID | 164762096 |
| Molecular Formula | C36H50O8 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyoctoxy]benzoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)c2ccc(OCCCCCCCCOC(=O)C(C)(CC(C)C)C(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C36H50O8/c1-26(2)25-36(5,27(3)4)35(39)43-23-13-11-9-8-10-12-22-42-30-18-16-29(17-19-30)34(38)44-31-20-14-28(24-32(31)40-6)15-21-33(37)41-7/h14-21,24,26-27H,8-13,22-23,25H2,1-7H3/b21-15+ |
| InChIKey | KNPSBYHPTICRIW-RCCKNPSSSA-N |
| XLogP | 8.07 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|