C31H39NO8 — CID 90137799
[4-[(E)-3-[2-(dimethylamino)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 90137799) has the molecular formula C31H39NO8 and a molecular weight of 553.65 g/mol. Its IUPAC name is [4-[(E)-3-[2-(dimethylamino)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [4-[(E)-3-[2-(dimethylamino)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 90137799 |
| Molecular Formula | C31H39NO8 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | [4-[(E)-3-[2-(dimethylamino)ethoxy]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OCCN(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C31H39NO8/c1-23(2)30(34)39-20-9-7-6-8-19-37-26-14-12-25(13-15-26)31(35)40-27-16-10-24(22-28(27)36-5)11-17-29(33)38-21-18-32(3)4/h10-17,22H,1,6-9,18-21H2,2-5H3/b17-11+ |
| InChIKey | JWTYWTYWMRQTRQ-GZTJUZNOSA-N |
| XLogP | 5.09 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|