C22H30O6 — CID 69118218
7-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]oxyheptyl 2-methylprop-2-enoate (PubChem CID 69118218) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 7-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]oxyheptyl 2-methylprop-2-enoate.
| Compound Name | 7-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]oxyheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69118218 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 7-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]oxyheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCOC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H30O6/c1-17(2)22(24)28-15-9-7-5-6-8-14-27-21(23)13-11-18-10-12-19(25-3)20(16-18)26-4/h10-13,16H,1,5-9,14-15H2,2-4H3/b13-11+ |
| InChIKey | WBCISBQKWQPUNP-ACCUITESSA-N |
| XLogP | 4.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|