C20H30O4 — CID 164675970
nonyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 164675970) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is nonyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | nonyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164675970 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | nonyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCCOC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H30O4/c1-4-5-6-7-8-9-10-15-24-20(21)14-12-17-11-13-18(22-2)19(16-17)23-3/h11-14,16H,4-10,15H2,1-3H3/b14-12+ |
| InChIKey | SFZSOYWKWFIADR-WYMLVPIESA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|