C17H24O4 — CID 142627715
hexyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 142627715) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is hexyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | hexyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142627715 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | hexyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCOC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H24O4/c1-4-5-6-7-12-21-17(18)11-9-14-8-10-15(19-2)16(13-14)20-3/h8-11,13H,4-7,12H2,1-3H3/b11-9+ |
| InChIKey | MHCRSILGLQYHLO-PKNBQFBNSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|