C42H56O10 — CID 123343081
6-[4-[3-[3-[4-[3-[(4-ethylcyclohexyl)methoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]propoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 123343081) has the molecular formula C42H56O10 and a molecular weight of 720.90 g/mol. Its IUPAC name is 6-[4-[3-[3-[4-[3-[(4-ethylcyclohexyl)methoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]propoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[3-[3-[4-[3-[(4-ethylcyclohexyl)methoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]propoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123343081 |
| Molecular Formula | C42H56O10 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | 6-[4-[3-[3-[4-[3-[(4-ethylcyclohexyl)methoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]propoxy]-3-oxoprop-1-enyl]-2-methoxyphenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C=CC(=O)OCCCOc2ccc(C=CC(=O)OCC3CCC(CC)CC3)cc2OC)cc1OC |
| InChI | InChI=1S/C42H56O10/c1-6-32-12-14-35(15-13-32)30-52-41(44)23-19-34-17-21-37(39(29-34)47-5)49-26-11-27-50-40(43)22-18-33-16-20-36(38(28-33)46-4)48-24-9-7-8-10-25-51-42(45)31(2)3/h16-23,28-29,32,35H,2,6-15,24-27,30H2,1,3-5H3 |
| InChIKey | IQJLLWQKQVWZJC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|