C27H40O6 — CID 67981387
[2-butyl-8-[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate (PubChem CID 67981387) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is [2-butyl-8-[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate.
| Compound Name | [2-butyl-8-[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67981387 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [2-butyl-8-[2-methoxy-4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCC)CCCCCCOc1ccc(C=CC(=O)OC)cc1OC |
| InChI | InChI=1S/C27H40O6/c1-6-7-12-23(20-33-27(29)21(2)3)13-10-8-9-11-18-32-24-16-14-22(19-25(24)30-4)15-17-26(28)31-5/h14-17,19,23H,2,6-13,18,20H2,1,3-5H3 |
| InChIKey | DWOUVRPBXYCREI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|