C15H19BrO4 — CID 168878232
methyl (E)-3-[4-(4-bromobutoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 168878232) has the molecular formula C15H19BrO4 and a molecular weight of 343.22 g/mol. Its IUPAC name is methyl (E)-3-[4-(4-bromobutoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(4-bromobutoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 168878232 |
| Molecular Formula | C15H19BrO4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | methyl (E)-3-[4-(4-bromobutoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCCCCBr)c(OC)c1 |
| InChI | InChI=1S/C15H19BrO4/c1-18-14-11-12(6-8-15(17)19-2)5-7-13(14)20-10-4-3-9-16/h5-8,11H,3-4,9-10H2,1-2H3/b8-6+ |
| InChIKey | VWEWZEYMQDJWPQ-SOFGYWHQSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|