C17H23BrO4 — CID 175497353
3-[4-(6-bromohexoxy)-3-methoxyphenyl]-2-methylprop-2-enoic acid (PubChem CID 175497353) has the molecular formula C17H23BrO4 and a molecular weight of 371.27 g/mol. Its IUPAC name is 3-[4-(6-bromohexoxy)-3-methoxyphenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-(6-bromohexoxy)-3-methoxyphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175497353 |
| Molecular Formula | C17H23BrO4 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-[4-(6-bromohexoxy)-3-methoxyphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1cc(C=C(C)C(=O)O)ccc1OCCCCCCBr |
| InChI | InChI=1S/C17H23BrO4/c1-13(17(19)20)11-14-7-8-15(16(12-14)21-2)22-10-6-4-3-5-9-18/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | BBBUBNVFRCNPFO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|