C19H18BrFO3 — CID 68506990
(E)-3-[4-(3-bromopropoxy)-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 68506990) has the molecular formula C19H18BrFO3 and a molecular weight of 393.25 g/mol. Its IUPAC name is (E)-3-[4-(3-bromopropoxy)-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(3-bromopropoxy)-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68506990 |
| Molecular Formula | C19H18BrFO3 |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (E)-3-[4-(3-bromopropoxy)-3-methoxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(F)cc2)ccc1OCCCBr |
| InChI | InChI=1S/C19H18BrFO3/c1-23-19-13-14(4-10-18(19)24-12-2-11-20)3-9-17(22)15-5-7-16(21)8-6-15/h3-10,13H,2,11-12H2,1H3/b9-3+ |
| InChIKey | YPPAGDAXRHARDB-YCRREMRBSA-N |
| XLogP | 4.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|