C19H18F2O4 — CID 75891151
3-(3,4-difluorophenyl)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]prop-2-en-1-one (PubChem CID 75891151) has the molecular formula C19H18F2O4 and a molecular weight of 348.35 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(3,4-difluorophenyl)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 75891151 |
| Molecular Formula | C19H18F2O4 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCCOc1ccc(C(=O)C=Cc2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C19H18F2O4/c1-23-9-10-25-18-8-5-14(12-19(18)24-2)17(22)7-4-13-3-6-15(20)16(21)11-13/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | ADDDGAMVVXIJBY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|