C17H14F2O4S — CID 48923127
(E)-3-(3,4-difluorophenyl)-1-(3-methoxy-4-methylsulfonylphenyl)prop-2-en-1-one (PubChem CID 48923127) has the molecular formula C17H14F2O4S and a molecular weight of 352.36 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-1-(3-methoxy-4-methylsulfonylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-difluorophenyl)-1-(3-methoxy-4-methylsulfonylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 48923127 |
| Molecular Formula | C17H14F2O4S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-1-(3-methoxy-4-methylsulfonylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2ccc(F)c(F)c2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C17H14F2O4S/c1-23-16-10-12(5-8-17(16)24(2,21)22)15(20)7-4-11-3-6-13(18)14(19)9-11/h3-10H,1-2H3/b7-4+ |
| InChIKey | QLQBZRWUFITLPU-QPJJXVBHSA-N |
| XLogP | 3.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|