C15H11BF2O3 — CID 10379336
[4-[(E)-3-(3,4-difluorophenyl)prop-2-enoyl]phenyl]boronic acid (PubChem CID 10379336) has the molecular formula C15H11BF2O3 and a molecular weight of 288.06 g/mol. Its IUPAC name is [4-[(E)-3-(3,4-difluorophenyl)prop-2-enoyl]phenyl]boronic acid.
| Compound Name | [4-[(E)-3-(3,4-difluorophenyl)prop-2-enoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 10379336 |
| Molecular Formula | C15H11BF2O3 |
| Molecular Weight | 288.06 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [4-[(E)-3-(3,4-difluorophenyl)prop-2-enoyl]phenyl]boronic acid |
| SMILES | O=C(/C=C/c1ccc(F)c(F)c1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H11BF2O3/c17-13-7-1-10(9-14(13)18)2-8-15(19)11-3-5-12(6-4-11)16(20)21/h1-9,20-21H/b8-2+ |
| InChIKey | IYFRSFJWVFBTRB-KRXBUXKQSA-N |
| XLogP | 1.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.06 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|