C15H9BrF2O2 — CID 69053713
1-(4-bromophenyl)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 69053713) has the molecular formula C15H9BrF2O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69053713 |
| Molecular Formula | C15H9BrF2O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 1-(4-bromophenyl)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)c(O)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H9BrF2O2/c16-11-4-2-10(3-5-11)14(19)6-1-9-7-12(17)15(20)13(18)8-9/h1-8,20H |
| InChIKey | XJTNFNPERFLFPE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|