C21H26BrClN2O2 — CID 6519527
(E)-3-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-1-(4-bromophenyl)prop-2-en-1-one;hydrochloride (PubChem CID 6519527) has the molecular formula C21H26BrClN2O2 and a molecular weight of 453.81 g/mol. Its IUPAC name is (E)-3-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-1-(4-bromophenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-3-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-1-(4-bromophenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 6519527 |
| Molecular Formula | C21H26BrClN2O2 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (E)-3-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-1-(4-bromophenyl)prop-2-en-1-one;hydrochloride |
| SMILES | CN(C)Cc1cc(/C=C/C(=O)c2ccc(Br)cc2)cc(CN(C)C)c1O.Cl |
| InChI | InChI=1S/C21H25BrN2O2.ClH/c1-23(2)13-17-11-15(12-18(21(17)26)14-24(3)4)5-10-20(25)16-6-8-19(22)9-7-16;/h5-12,26H,13-14H2,1-4H3;1H/b10-5+; |
| InChIKey | YHBBZRJKWYBMEW-OAZHBLANSA-N |
| XLogP | 4.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|