C21H24Cl2N2O2 — CID 92531636
(Z)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 92531636) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is (Z)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (Z)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 92531636 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (Z)-1-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]-3-(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | CN(C)Cc1cc(C(=O)/C=C\c2ccc(Cl)c(Cl)c2)cc(CN(C)C)c1O |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-24(2)12-16-10-15(11-17(21(16)27)13-25(3)4)20(26)8-6-14-5-7-18(22)19(23)9-14/h5-11,27H,12-13H2,1-4H3/b8-6- |
| InChIKey | RRHGMVUZICVUKN-VURMDHGXSA-N |
| XLogP | 4.72 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|