C20H28Cl2N2O — CID 19004625
(E)-3-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylcyclohexyl)prop-2-enamide (PubChem CID 19004625) has the molecular formula C20H28Cl2N2O and a molecular weight of 383.36 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 19004625 |
| Molecular Formula | C20H28Cl2N2O |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-(dimethylamino)ethyl]-N-(4-methylcyclohexyl)prop-2-enamide |
| SMILES | CC1CCC(N(CCN(C)C)C(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H28Cl2N2O/c1-15-4-8-17(9-5-15)24(13-12-23(2)3)20(25)11-7-16-6-10-18(21)19(22)14-16/h6-7,10-11,14-15,17H,4-5,8-9,12-13H2,1-3H3/b11-7+ |
| InChIKey | IQLCQGFLKMLBAT-YRNVUSSQSA-N |
| XLogP | 4.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|