C15H15Cl2NO3 — CID 60845085
3-[cyclopropyl-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 60845085) has the molecular formula C15H15Cl2NO3 and a molecular weight of 328.19 g/mol. Its IUPAC name is 3-[cyclopropyl-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 60845085 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-[cyclopropyl-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)/C=C/c1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-12-5-1-10(9-13(12)17)2-6-14(19)18(11-3-4-11)8-7-15(20)21/h1-2,5-6,9,11H,3-4,7-8H2,(H,20,21)/b6-2+ |
| InChIKey | RKUCZRDZXHPUQR-QHHAFSJGSA-N |
| XLogP | 3.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|