C18H20ClNO6 — CID 126794347
3-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid (PubChem CID 126794347) has the molecular formula C18H20ClNO6 and a molecular weight of 381.81 g/mol. Its IUPAC name is 3-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 126794347 |
| Molecular Formula | C18H20ClNO6 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)C=Cc1cc(Cl)c2c(c1)OCO2)C1CCOCC1 |
| InChI | InChI=1S/C18H20ClNO6/c19-14-9-12(10-15-18(14)26-11-25-15)1-2-16(21)20(6-3-17(22)23)13-4-7-24-8-5-13/h1-2,9-10,13H,3-8,11H2,(H,22,23) |
| InChIKey | UFTUTUGZRVKCSJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|