C17H18F3NO4 — CID 90554750
(E)-3-(1,3-benzodioxol-5-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 90554750) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 90554750 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C17H18F3NO4/c18-17(19,20)10-21(13-5-7-23-8-6-13)16(22)4-2-12-1-3-14-15(9-12)25-11-24-14/h1-4,9,13H,5-8,10-11H2/b4-2+ |
| InChIKey | ZBMZGEYPFBHKJD-DUXPYHPUSA-N |
| XLogP | 3.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|