C20H21NO5 — CID 71801511
(E)-3-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)prop-2-enamide (PubChem CID 71801511) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71801511 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-N-(oxan-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N(Cc1ccco1)C1CCOCC1 |
| InChI | InChI=1S/C20H21NO5/c22-20(6-4-15-3-5-18-19(12-15)26-14-25-18)21(13-17-2-1-9-24-17)16-7-10-23-11-8-16/h1-6,9,12,16H,7-8,10-11,13-14H2/b6-4+ |
| InChIKey | SJAOHOQAYGSHMD-GQCTYLIASA-N |
| XLogP | 3.23 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|