C15H23NO3 — CID 121131278
N-(furan-2-ylmethyl)-2,2-dimethyl-N-(oxan-4-yl)propanamide (PubChem CID 121131278) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,2-dimethyl-N-(oxan-4-yl)propanamide.
| Compound Name | N-(furan-2-ylmethyl)-2,2-dimethyl-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 121131278 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,2-dimethyl-N-(oxan-4-yl)propanamide |
| SMILES | CC(C)(C)C(=O)N(Cc1ccco1)C1CCOCC1 |
| InChI | InChI=1S/C15H23NO3/c1-15(2,3)14(17)16(11-13-5-4-8-19-13)12-6-9-18-10-7-12/h4-5,8,12H,6-7,9-11H2,1-3H3 |
| InChIKey | PQOLXBVDEJPJTP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |