C20H25NO6 — CID 121131308
N-(furan-2-ylmethyl)-3,4,5-trimethoxy-N-(oxan-4-yl)benzamide (PubChem CID 121131308) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,4,5-trimethoxy-N-(oxan-4-yl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3,4,5-trimethoxy-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 121131308 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,4,5-trimethoxy-N-(oxan-4-yl)benzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccco2)C2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25NO6/c1-23-17-11-14(12-18(24-2)19(17)25-3)20(22)21(13-16-5-4-8-27-16)15-6-9-26-10-7-15/h4-5,8,11-12,15H,6-7,9-10,13H2,1-3H3 |
| InChIKey | XIOCDENCIGBDPO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |