C15H16ClNO4 — CID 27719528
3-chloro-N-(furan-2-ylmethyl)-4,5-dimethoxy-N-methylbenzamide (PubChem CID 27719528) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is 3-chloro-N-(furan-2-ylmethyl)-4,5-dimethoxy-N-methylbenzamide.
| Compound Name | 3-chloro-N-(furan-2-ylmethyl)-4,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 27719528 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-chloro-N-(furan-2-ylmethyl)-4,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccco2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H16ClNO4/c1-17(9-11-5-4-6-21-11)15(18)10-7-12(16)14(20-3)13(8-10)19-2/h4-8H,9H2,1-3H3 |
| InChIKey | BSXXYQTYBNFJNG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |