C18H22ClNO4 — CID 55334280
3-chloro-N-(furan-2-ylmethyl)-5-methoxy-N-methyl-4-(2-methylpropoxy)benzamide (PubChem CID 55334280) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is 3-chloro-N-(furan-2-ylmethyl)-5-methoxy-N-methyl-4-(2-methylpropoxy)benzamide.
| Compound Name | 3-chloro-N-(furan-2-ylmethyl)-5-methoxy-N-methyl-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 55334280 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-chloro-N-(furan-2-ylmethyl)-5-methoxy-N-methyl-4-(2-methylpropoxy)benzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccco2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C18H22ClNO4/c1-12(2)11-24-17-15(19)8-13(9-16(17)22-4)18(21)20(3)10-14-6-5-7-23-14/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | KXMUHVKEOHJKKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |