C16H19NO4 — CID 31288728
N-(furan-2-ylmethyl)-3,5-dimethoxy-N,4-dimethylbenzamide (PubChem CID 31288728) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,5-dimethoxy-N,4-dimethylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-3,5-dimethoxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 31288728 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,5-dimethoxy-N,4-dimethylbenzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccco2)cc(OC)c1C |
| InChI | InChI=1S/C16H19NO4/c1-11-14(19-3)8-12(9-15(11)20-4)16(18)17(2)10-13-6-5-7-21-13/h5-9H,10H2,1-4H3 |
| InChIKey | FDZZZXXSHZXVGQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |