C18H19Cl2NO3 — CID 112790252
3-chloro-N-[(2-chlorophenyl)methyl]-4-ethoxy-5-methoxy-N-methylbenzamide (PubChem CID 112790252) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 3-chloro-N-[(2-chlorophenyl)methyl]-4-ethoxy-5-methoxy-N-methylbenzamide.
| Compound Name | 3-chloro-N-[(2-chlorophenyl)methyl]-4-ethoxy-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 112790252 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 3-chloro-N-[(2-chlorophenyl)methyl]-4-ethoxy-5-methoxy-N-methylbenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)N(C)Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO3/c1-4-24-17-15(20)9-13(10-16(17)23-3)18(22)21(2)11-12-7-5-6-8-14(12)19/h5-10H,4,11H2,1-3H3 |
| InChIKey | VGZPBLJLHKTXKE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |