C20H24ClNO3 — CID 112790343
N-[(2-chlorophenyl)methyl]-3-methoxy-N-methyl-4-(2-methylpropoxy)benzamide (PubChem CID 112790343) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-methoxy-N-methyl-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-methoxy-N-methyl-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 112790343 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-methoxy-N-methyl-4-(2-methylpropoxy)benzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2ccccc2Cl)ccc1OCC(C)C |
| InChI | InChI=1S/C20H24ClNO3/c1-14(2)13-25-18-10-9-15(11-19(18)24-4)20(23)22(3)12-16-7-5-6-8-17(16)21/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | OKDXYIVXTNVDFV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |