C19H22ClNO3S — CID 26619232
3-chloro-4-ethoxy-5-methoxy-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide (PubChem CID 26619232) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 26619232 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)N(C)Cc2ccc(SC)cc2)cc1OC |
| InChI | InChI=1S/C19H22ClNO3S/c1-5-24-18-16(20)10-14(11-17(18)23-3)19(22)21(2)12-13-6-8-15(25-4)9-7-13/h6-11H,5,12H2,1-4H3 |
| InChIKey | DIPKJZYQLHRMMX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |